C16H14FN3O5 — CID 10521565
2-[3-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-3-methoxypropyl]isoindole-1,3-dione (PubChem CID 10521565) has the molecular formula C16H14FN3O5 and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-[3-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-3-methoxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-3-methoxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10521565 |
| Molecular Formula | C16H14FN3O5 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[3-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)-3-methoxypropyl]isoindole-1,3-dione |
| SMILES | COC(CCN1C(=O)c2ccccc2C1=O)n1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C16H14FN3O5/c1-25-12(20-15(23)11(17)8-18-16(20)24)6-7-19-13(21)9-4-2-3-5-10(9)14(19)22/h2-5,8,12H,6-7H2,1H3,(H,18,24) |
| InChIKey | AKPPNIGYDBAAPK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|