C22H23ClN4O3 — CID 121437768
5-[3-[4-(3-chlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 121437768) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 5-[3-[4-(3-chlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-(3-chlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121437768 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-[3-[4-(3-chlorophenyl)piperazin-1-yl]-3-oxopropyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2CCN(c3cccc(Cl)c3)CC2)(c2ccccc2)N1 |
| InChI | InChI=1S/C22H23ClN4O3/c23-17-7-4-8-18(15-17)26-11-13-27(14-12-26)19(28)9-10-22(16-5-2-1-3-6-16)20(29)24-21(30)25-22/h1-8,15H,9-14H2,(H2,24,25,29,30) |
| InChIKey | BLPSVYQVAGCHMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|