C8H15NO4 — CID 121439864
2-[(2-methylpropan-2-yl)oxycarbonyl-(trideuteriomethyl)amino]acetic acid (PubChem CID 121439864) has the molecular formula C8H15NO4 and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonyl-(trideuteriomethyl)amino]acetic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-(trideuteriomethyl)amino]acetic acid |
|---|---|
| PubChem CID | 121439864 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-(trideuteriomethyl)amino]acetic acid |
| SMILES | [2H]C([2H])([2H])N(CC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-7(12)9(4)5-6(10)11/h5H2,1-4H3,(H,10,11)/i4D3 |
| InChIKey | YRXIMPFOTQVOHG-GKOSEXJESA-N |
| XLogP | 0.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |