C9H15NO4 — CID 18784338
2-[ethenyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (PubChem CID 18784338) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[ethenyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid.
| Compound Name | 2-[ethenyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 18784338 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[ethenyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| SMILES | C=CN(CC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15NO4/c1-5-10(6-7(11)12)8(13)14-9(2,3)4/h5H,1,6H2,2-4H3,(H,11,12) |
| InChIKey | IUDCOFLCWUPPMC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |