C36H76N6 — CID 121440814
10,11-bis[8-(aminodiazenyl)octyl]icosane (PubChem CID 121440814) has the molecular formula C36H76N6 and a molecular weight of 593.05 g/mol. Its IUPAC name is 10,11-bis[8-(aminodiazenyl)octyl]icosane.
| Compound Name | 10,11-bis[8-(aminodiazenyl)octyl]icosane |
|---|---|
| PubChem CID | 121440814 |
| Molecular Formula | C36H76N6 |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 592.61 |
| IUPAC Name | 10,11-bis[8-(aminodiazenyl)octyl]icosane |
| SMILES | CCCCCCCCCC(CCCCCCCC/N=N/N)C(CCCCCCCCC)CCCCCCCC/N=N/N |
| InChI | InChI=1S/C36H76N6/c1-3-5-7-9-11-17-23-29-35(31-25-19-13-15-21-27-33-39-41-37)36(30-24-18-12-10-8-6-4-2)32-26-20-14-16-22-28-34-40-42-38/h35-36H,3-34H2,1-2H3,(H2,37,39)(H2,38,40) |
| InChIKey | SMZRJQFWTXVONL-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|