C24H34N4O2 — CID 121440834
1-(1-adamantyl)-1-amino-3-[(1-benzoylpiperidin-4-yl)methyl]urea (PubChem CID 121440834) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-(1-adamantyl)-1-amino-3-[(1-benzoylpiperidin-4-yl)methyl]urea.
| Compound Name | 1-(1-adamantyl)-1-amino-3-[(1-benzoylpiperidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 121440834 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1-(1-adamantyl)-1-amino-3-[(1-benzoylpiperidin-4-yl)methyl]urea |
| SMILES | NN(C(=O)NCC1CCN(C(=O)c2ccccc2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H34N4O2/c25-28(24-13-18-10-19(14-24)12-20(11-18)15-24)23(30)26-16-17-6-8-27(9-7-17)22(29)21-4-2-1-3-5-21/h1-5,17-20H,6-16,25H2,(H,26,30) |
| InChIKey | UNGCOTVHIXIANW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|