C24H33N3O3 — CID 121440841
2-[4-[[2-(1-adamantyl)hydrazinyl]methyl]piperidine-1-carbonyl]benzoic acid (PubChem CID 121440841) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[4-[[2-(1-adamantyl)hydrazinyl]methyl]piperidine-1-carbonyl]benzoic acid.
| Compound Name | 2-[4-[[2-(1-adamantyl)hydrazinyl]methyl]piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 121440841 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[4-[[2-(1-adamantyl)hydrazinyl]methyl]piperidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N1CCC(CNNC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C24H33N3O3/c28-22(20-3-1-2-4-21(20)23(29)30)27-7-5-16(6-8-27)15-25-26-24-12-17-9-18(13-24)11-19(10-17)14-24/h1-4,16-19,25-26H,5-15H2,(H,29,30) |
| InChIKey | ZKQXTQXDIULWSK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|