C17H16N6O — CID 121441064
11-(1-propylpyrrolo[3,2-b]pyridin-5-yl)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene (PubChem CID 121441064) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 11-(1-propylpyrrolo[3,2-b]pyridin-5-yl)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene.
| Compound Name | 11-(1-propylpyrrolo[3,2-b]pyridin-5-yl)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene |
|---|---|
| PubChem CID | 121441064 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 11-(1-propylpyrrolo[3,2-b]pyridin-5-yl)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene |
| SMILES | CCCn1ccc2nc(N3CCOc4ncnc5c4C3=N5)ccc21 |
| InChI | InChI=1S/C17H16N6O/c1-2-6-22-7-5-11-12(22)3-4-13(20-11)23-8-9-24-17-14-15(18-10-19-17)21-16(14)23/h3-5,7,10H,2,6,8-9H2,1H3 |
| InChIKey | ZXRPEZPLCVKDDO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |