C35H40N8O4 — CID 121443951
N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[[3-[[4-(prop-2-enoylamino)benzoyl]amino]benzoyl]amino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide (PubChem CID 121443951) has the molecular formula C35H40N8O4 and a molecular weight of 636.76 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[[3-[[4-(prop-2-enoylamino)benzoyl]amino]benzoyl]amino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[[3-[[4-(prop-2-enoylamino)benzoyl]amino]benzoyl]amino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121443951 |
| Molecular Formula | C35H40N8O4 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[[3-[[4-(prop-2-enoylamino)benzoyl]amino]benzoyl]amino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Nc2cccc(C(=O)NC3NNC4=C3CN(C(=O)N[C@H](CN(C)C)c3ccccc3)C4(C)C)c2)cc1 |
| InChI | InChI=1S/C35H40N8O4/c1-6-29(44)36-25-17-15-23(16-18-25)32(45)37-26-14-10-13-24(19-26)33(46)39-31-27-20-43(35(2,3)30(27)40-41-31)34(47)38-28(21-42(4)5)22-11-8-7-9-12-22/h6-19,28,31,40-41H,1,20-21H2,2-5H3,(H,36,44)(H,37,45)(H,38,47)(H,39,46)/t28-,31?/m1/s1 |
| InChIKey | KILKCOISEYTNAG-ZZTVPSNHSA-N |
| XLogP | 3.59 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|