C27H35N7O2 — CID 121443984
N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[3-(prop-2-enoylamino)anilino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide (PubChem CID 121443984) has the molecular formula C27H35N7O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[3-(prop-2-enoylamino)anilino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[3-(prop-2-enoylamino)anilino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121443984 |
| Molecular Formula | C27H35N7O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[3-(prop-2-enoylamino)anilino]-1,2,3,4-tetrahydropyrrolo[3,4-c]pyrazole-5-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(NC2NNC3=C2CN(C(=O)N[C@H](CN(C)C)c2ccccc2)C3(C)C)c1 |
| InChI | InChI=1S/C27H35N7O2/c1-6-23(35)28-19-13-10-14-20(15-19)29-25-21-16-34(27(2,3)24(21)31-32-25)26(36)30-22(17-33(4)5)18-11-8-7-9-12-18/h6-15,22,25,29,31-32H,1,16-17H2,2-5H3,(H,28,35)(H,30,36)/t22-,25?/m1/s1 |
| InChIKey | RPKHWYZVHUWGKG-UFUCKMQHSA-N |
| XLogP | 3.02 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|