C18H18F2N2O4 — CID 121446355
4-[4-[4-(cyclopropylmethoxy)pyrimidin-2-yl]-2,6-difluorophenoxy]butanoic acid (PubChem CID 121446355) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is 4-[4-[4-(cyclopropylmethoxy)pyrimidin-2-yl]-2,6-difluorophenoxy]butanoic acid.
| Compound Name | 4-[4-[4-(cyclopropylmethoxy)pyrimidin-2-yl]-2,6-difluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 121446355 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[4-[4-(cyclopropylmethoxy)pyrimidin-2-yl]-2,6-difluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(F)cc(-c2nccc(OCC3CC3)n2)cc1F |
| InChI | InChI=1S/C18H18F2N2O4/c19-13-8-12(9-14(20)17(13)25-7-1-2-16(23)24)18-21-6-5-15(22-18)26-10-11-3-4-11/h5-6,8-9,11H,1-4,7,10H2,(H,23,24) |
| InChIKey | XURWRQIAPZCHLI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|