C19H20F2N2O4 — CID 121447519
4-[4-(4-cyclobutyloxy-6-methylpyrimidin-2-yl)-2,6-difluorophenoxy]butanoic acid (PubChem CID 121447519) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4-[4-(4-cyclobutyloxy-6-methylpyrimidin-2-yl)-2,6-difluorophenoxy]butanoic acid.
| Compound Name | 4-[4-(4-cyclobutyloxy-6-methylpyrimidin-2-yl)-2,6-difluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447519 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-[4-(4-cyclobutyloxy-6-methylpyrimidin-2-yl)-2,6-difluorophenoxy]butanoic acid |
| SMILES | Cc1cc(OC2CCC2)nc(-c2cc(F)c(OCCCC(=O)O)c(F)c2)n1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-11-8-16(27-13-4-2-5-13)23-19(22-11)12-9-14(20)18(15(21)10-12)26-7-3-6-17(24)25/h8-10,13H,2-7H2,1H3,(H,24,25) |
| InChIKey | YYOSVPKSTVCXAK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|