C17H22Cl2N2O2 — CID 121448950
1-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-ethylpentane-1,4-dione (PubChem CID 121448950) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-ethylpentane-1,4-dione.
| Compound Name | 1-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-ethylpentane-1,4-dione |
|---|---|
| PubChem CID | 121448950 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-ethylpentane-1,4-dione |
| SMILES | CCC(CC(C)=O)C(=O)N1CCN(c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-3-13(8-12(2)22)17(23)21-6-4-20(5-7-21)16-10-14(18)9-15(19)11-16/h9-11,13H,3-8H2,1-2H3 |
| InChIKey | MZBYAZAIKAOAKW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |