C11H15NO — CID 121450182
8a-prop-2-enyl-1,2,5,8-tetrahydroindolizin-3-one (PubChem CID 121450182) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 8a-prop-2-enyl-1,2,5,8-tetrahydroindolizin-3-one.
| Compound Name | 8a-prop-2-enyl-1,2,5,8-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 121450182 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8a-prop-2-enyl-1,2,5,8-tetrahydroindolizin-3-one |
| SMILES | C=CCC12CC=CCN1C(=O)CC2 |
| InChI | InChI=1S/C11H15NO/c1-2-6-11-7-3-4-9-12(11)10(13)5-8-11/h2-4H,1,5-9H2 |
| InChIKey | DSZZMVOJZCPJLY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|