C25H28N2O5 — CID 121451836
4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzonitrile (PubChem CID 121451836) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzonitrile.
| Compound Name | 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 121451836 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1Oc1ccc(N2CC(OCCOC3CCCCO3)C2)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-18(28)23-10-5-19(15-26)14-24(23)32-21-8-6-20(7-9-21)27-16-22(17-27)29-12-13-31-25-4-2-3-11-30-25/h5-10,14,22,25H,2-4,11-13,16-17H2,1H3 |
| InChIKey | VCEPINATXUAPMB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|