C25H30N2O6 — CID 121451898
4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzamide (PubChem CID 121451898) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzamide.
| Compound Name | 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzamide |
|---|---|
| PubChem CID | 121451898 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-acetyl-3-[4-[3-[2-(oxan-2-yloxy)ethoxy]azetidin-1-yl]phenoxy]benzamide |
| SMILES | CC(=O)c1ccc(C(N)=O)cc1Oc1ccc(N2CC(OCCOC3CCCCO3)C2)cc1 |
| InChI | InChI=1S/C25H30N2O6/c1-17(28)22-10-5-18(25(26)29)14-23(22)33-20-8-6-19(7-9-20)27-15-21(16-27)30-12-13-32-24-4-2-3-11-31-24/h5-10,14,21,24H,2-4,11-13,15-16H2,1H3,(H2,26,29) |
| InChIKey | ZQPTXKJPHVJJBT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|