C32H37N3O6 — CID 121453627
2-O-tert-butyl 7-O-methyl 6-[1-[(4-hydroxyphenyl)-methylcarbamoyl]-5,6,7,8-tetrahydroindolizin-3-yl]-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate (PubChem CID 121453627) has the molecular formula C32H37N3O6 and a molecular weight of 559.66 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-methyl 6-[1-[(4-hydroxyphenyl)-methylcarbamoyl]-5,6,7,8-tetrahydroindolizin-3-yl]-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-methyl 6-[1-[(4-hydroxyphenyl)-methylcarbamoyl]-5,6,7,8-tetrahydroindolizin-3-yl]-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate |
|---|---|
| PubChem CID | 121453627 |
| Molecular Formula | C32H37N3O6 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 2-O-tert-butyl 7-O-methyl 6-[1-[(4-hydroxyphenyl)-methylcarbamoyl]-5,6,7,8-tetrahydroindolizin-3-yl]-3,4-dihydro-1H-isoquinoline-2,7-dicarboxylate |
| SMILES | COC(=O)c1cc2c(cc1-c1cc(C(=O)N(C)c3ccc(O)cc3)c3n1CCCC3)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C32H37N3O6/c1-32(2,3)41-31(39)34-15-13-20-16-24(25(30(38)40-5)17-21(20)19-34)28-18-26(27-8-6-7-14-35(27)28)29(37)33(4)22-9-11-23(36)12-10-22/h9-12,16-18,36H,6-8,13-15,19H2,1-5H3 |
| InChIKey | UCIHYAZNVJSJOO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |