C17H16FIN2O2 — CID 121454910
N-(4-cyclopropyl-2-pyridinyl)-5-ethoxy-2-fluoro-4-iodobenzamide (PubChem CID 121454910) has the molecular formula C17H16FIN2O2 and a molecular weight of 426.23 g/mol. Its IUPAC name is N-(4-cyclopropyl-2-pyridinyl)-5-ethoxy-2-fluoro-4-iodobenzamide.
| Compound Name | N-(4-cyclopropyl-2-pyridinyl)-5-ethoxy-2-fluoro-4-iodobenzamide |
|---|---|
| PubChem CID | 121454910 |
| Molecular Formula | C17H16FIN2O2 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | N-(4-cyclopropyl-2-pyridinyl)-5-ethoxy-2-fluoro-4-iodobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cc(C3CC3)ccn2)c(F)cc1I |
| InChI | InChI=1S/C17H16FIN2O2/c1-2-23-15-8-12(13(18)9-14(15)19)17(22)21-16-7-11(5-6-20-16)10-3-4-10/h5-10H,2-4H2,1H3,(H,20,21,22) |
| InChIKey | YXWXOUGVLIZPTF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|