C12H20O4 — CID 121455279
1-(1-methoxy-2-methyl-1-oxopropan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 121455279) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(1-methoxy-2-methyl-1-oxopropan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(1-methoxy-2-methyl-1-oxopropan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121455279 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-(1-methoxy-2-methyl-1-oxopropan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | COC(=O)C(C)(C)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C12H20O4/c1-11(2,10(15)16-3)12(9(13)14)7-5-4-6-8-12/h4-8H2,1-3H3,(H,13,14) |
| InChIKey | GMBHRIHQWRHTPV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |