C34H58O7 — CID 57006315
1-[bis(1-carboxycyclodecyl)-hydroxymethyl]cyclodecane-1-carboxylic acid (PubChem CID 57006315) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is 1-[bis(1-carboxycyclodecyl)-hydroxymethyl]cyclodecane-1-carboxylic acid.
| Compound Name | 1-[bis(1-carboxycyclodecyl)-hydroxymethyl]cyclodecane-1-carboxylic acid |
|---|---|
| PubChem CID | 57006315 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | 1-[bis(1-carboxycyclodecyl)-hydroxymethyl]cyclodecane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(O)(C2(C(=O)O)CCCCCCCCC2)C2(C(=O)O)CCCCCCCCC2)CCCCCCCCC1 |
| InChI | InChI=1S/C34H58O7/c35-28(36)31(22-16-10-4-1-5-11-17-23-31)34(41,32(29(37)38)24-18-12-6-2-7-13-19-25-32)33(30(39)40)26-20-14-8-3-9-15-21-27-33/h41H,1-27H2,(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | BAEHTSMSULDOLL-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |