C18H20F2O3 — CID 121455314
(2S,3R)-3-[(2,4-difluorophenoxy)methyl]-4-(4-methoxyphenyl)butan-2-ol (PubChem CID 121455314) has the molecular formula C18H20F2O3 and a molecular weight of 322.35 g/mol. Its IUPAC name is (2S,3R)-3-[(2,4-difluorophenoxy)methyl]-4-(4-methoxyphenyl)butan-2-ol.
| Compound Name | (2S,3R)-3-[(2,4-difluorophenoxy)methyl]-4-(4-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 121455314 |
| Molecular Formula | C18H20F2O3 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2S,3R)-3-[(2,4-difluorophenoxy)methyl]-4-(4-methoxyphenyl)butan-2-ol |
| SMILES | COc1ccc(C[C@H](COc2ccc(F)cc2F)[C@H](C)O)cc1 |
| InChI | InChI=1S/C18H20F2O3/c1-12(21)14(9-13-3-6-16(22-2)7-4-13)11-23-18-8-5-15(19)10-17(18)20/h3-8,10,12,14,21H,9,11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | WACHOHJDTQCLDK-GXTWGEPZSA-N |
| XLogP | 3.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |