C39H39N3O8 — CID 121458188
methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-4-[(4-formylphenoxy)methyl]-13-oxo-11-phenylmethoxy-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate (PubChem CID 121458188) has the molecular formula C39H39N3O8 and a molecular weight of 677.75 g/mol. Its IUPAC name is methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-4-[(4-formylphenoxy)methyl]-13-oxo-11-phenylmethoxy-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate.
| Compound Name | methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-4-[(4-formylphenoxy)methyl]-13-oxo-11-phenylmethoxy-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 121458188 |
| Molecular Formula | C39H39N3O8 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-4-[(4-formylphenoxy)methyl]-13-oxo-11-phenylmethoxy-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate |
| SMILES | CCn1c(COc2ccc(C=O)cc2)nc2c1CCCc1c(OCc3ccccc3)c(C(=O)OC)c(=O)n(Cc3ccc(OC)cc3OC)c1-2 |
| InChI | InChI=1S/C39H39N3O8/c1-5-41-31-13-9-12-30-36(35(31)40-33(41)24-49-28-17-14-25(22-43)15-18-28)42(21-27-16-19-29(46-2)20-32(27)47-3)38(44)34(39(45)48-4)37(30)50-23-26-10-7-6-8-11-26/h6-8,10-11,14-20,22H,5,9,12-13,21,23-24H2,1-4H3 |
| InChIKey | IXOBMJFFCHEELG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 120.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|