C33H37N3O7 — CID 121457945
methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-11-hydroxy-13-oxo-4-(2-phenylmethoxyethyl)-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate (PubChem CID 121457945) has the molecular formula C33H37N3O7 and a molecular weight of 587.67 g/mol. Its IUPAC name is methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-11-hydroxy-13-oxo-4-(2-phenylmethoxyethyl)-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate.
| Compound Name | methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-11-hydroxy-13-oxo-4-(2-phenylmethoxyethyl)-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 121457945 |
| Molecular Formula | C33H37N3O7 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | methyl 14-[(2,4-dimethoxyphenyl)methyl]-5-ethyl-11-hydroxy-13-oxo-4-(2-phenylmethoxyethyl)-3,5,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11-tetraene-12-carboxylate |
| SMILES | CCn1c(CCOCc2ccccc2)nc2c1CCCc1c(O)c(C(=O)OC)c(=O)n(Cc3ccc(OC)cc3OC)c1-2 |
| InChI | InChI=1S/C33H37N3O7/c1-5-35-25-13-9-12-24-30(29(25)34-27(35)16-17-43-20-21-10-7-6-8-11-21)36(32(38)28(31(24)37)33(39)42-4)19-22-14-15-23(40-2)18-26(22)41-3/h6-8,10-11,14-15,18,37H,5,9,12-13,16-17,19-20H2,1-4H3 |
| InChIKey | LVQYXLYORSYBJU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|