C31H38ClNO7Si — CID 71285477
methyl 10-[tert-butyl(dimethyl)silyl]oxy-13-chloro-3-[(2,4-dimethoxyphenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),5,12,14-pentaene-5-carboxylate (PubChem CID 71285477) has the molecular formula C31H38ClNO7Si and a molecular weight of 600.18 g/mol. Its IUPAC name is methyl 10-[tert-butyl(dimethyl)silyl]oxy-13-chloro-3-[(2,4-dimethoxyphenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),5,12,14-pentaene-5-carboxylate.
| Compound Name | methyl 10-[tert-butyl(dimethyl)silyl]oxy-13-chloro-3-[(2,4-dimethoxyphenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),5,12,14-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 71285477 |
| Molecular Formula | C31H38ClNO7Si |
| Molecular Weight | 600.18 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | methyl 10-[tert-butyl(dimethyl)silyl]oxy-13-chloro-3-[(2,4-dimethoxyphenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),5,12,14-pentaene-5-carboxylate |
| SMILES | COC(=O)c1c(O)c2c(n(Cc3ccc(OC)cc3OC)c1=O)-c1ccc(Cl)cc1C(O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C31H38ClNO7Si/c1-31(2,3)41(7,8)40-24-14-13-22-27(21-12-10-19(32)15-23(21)24)33(29(35)26(28(22)34)30(36)39-6)17-18-9-11-20(37-4)16-25(18)38-5/h9-12,15-16,24,34H,13-14,17H2,1-8H3 |
| InChIKey | SOTNDURUXYYEOO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.18 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|