C27H25ClN6O4 — CID 121458823
2-[4-[4-[6-chloro-2-[(3R,5S,6S)-6-(hydroxymethyl)-5-methyloxan-3-yl]oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 121458823) has the molecular formula C27H25ClN6O4 and a molecular weight of 532.99 g/mol. Its IUPAC name is 2-[4-[4-[6-chloro-2-[(3R,5S,6S)-6-(hydroxymethyl)-5-methyloxan-3-yl]oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 2-[4-[4-[6-chloro-2-[(3R,5S,6S)-6-(hydroxymethyl)-5-methyloxan-3-yl]oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 121458823 |
| Molecular Formula | C27H25ClN6O4 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[4-[4-[6-chloro-2-[(3R,5S,6S)-6-(hydroxymethyl)-5-methyloxan-3-yl]oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | C[C@H]1C[C@@H](Oc2nc3nc(-c4ccc(-c5ccc(-n6cnc(=O)[nH]6)cc5)cc4)c(Cl)cc3[nH]2)CO[C@@H]1CO |
| InChI | InChI=1S/C27H25ClN6O4/c1-15-10-20(13-37-23(15)12-35)38-27-30-22-11-21(28)24(31-25(22)32-27)18-4-2-16(3-5-18)17-6-8-19(9-7-17)34-14-29-26(36)33-34/h2-9,11,14-15,20,23,35H,10,12-13H2,1H3,(H,33,36)(H,30,31,32)/t15-,20+,23+/m0/s1 |
| InChIKey | ARNLGEUHRYVOCP-UYGSHGSRSA-N |
| XLogP | 3.98 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |