C22H25ClN4O6S — CID 90077308
(2R,3S,5R)-5-[[6-chloro-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2-(hydroxymethyl)oxan-3-ol (PubChem CID 90077308) has the molecular formula C22H25ClN4O6S and a molecular weight of 508.98 g/mol. Its IUPAC name is (2R,3S,5R)-5-[[6-chloro-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2-(hydroxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,5R)-5-[[6-chloro-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2-(hydroxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 90077308 |
| Molecular Formula | C22H25ClN4O6S |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2R,3S,5R)-5-[[6-chloro-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2-(hydroxymethyl)oxan-3-ol |
| SMILES | O=S1(=O)CCN(c2ccc(-c3nc4nc(O[C@H]5CO[C@H](CO)[C@@H](O)C5)[nH]c4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN4O6S/c23-16-10-17-21(26-22(24-17)33-15-9-18(29)19(11-28)32-12-15)25-20(16)13-1-3-14(4-2-13)27-5-7-34(30,31)8-6-27/h1-4,10,15,18-19,28-29H,5-9,11-12H2,(H,24,25,26)/t15-,18+,19-/m1/s1 |
| InChIKey | UURGVDOZKOAZEG-AYOQOUSVSA-N |
| XLogP | 1.40 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |