C70H50N6 — CID 121459405
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(6-methyl-9-phenyl-4b,8a-dihydrocarbazol-3-yl)-6-(6-phenyl-4,8a-dihydrocarbazol-9-yl)carbazole (PubChem CID 121459405) has the molecular formula C70H50N6 and a molecular weight of 975.21 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(6-methyl-9-phenyl-4b,8a-dihydrocarbazol-3-yl)-6-(6-phenyl-4,8a-dihydrocarbazol-9-yl)carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(6-methyl-9-phenyl-4b,8a-dihydrocarbazol-3-yl)-6-(6-phenyl-4,8a-dihydrocarbazol-9-yl)carbazole |
|---|---|
| PubChem CID | 121459405 |
| Molecular Formula | C70H50N6 |
| Molecular Weight | 975.21 g/mol |
| Exact Mass | 974.41 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(6-methyl-9-phenyl-4b,8a-dihydrocarbazol-3-yl)-6-(6-phenyl-4,8a-dihydrocarbazol-9-yl)carbazole |
| SMILES | CC1=CC2c3cc(-c4ccc5c(c4)c4cc(N6C7=CC=CCC7=C7C=C(c8ccccc8)C=CC76)ccc4n5-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)ccc3N(c3ccccc3)C2C=C1 |
| InChI | InChI=1S/C70H50N6/c1-45-26-35-63-57(40-45)59-42-51(30-37-65(59)74(63)53-22-12-5-13-23-53)52-31-38-66-60(43-52)61-44-55(76-62-25-15-14-24-56(62)58-41-50(29-36-64(58)76)46-16-6-2-7-17-46)34-39-67(61)75(66)54-32-27-49(28-33-54)70-72-68(47-18-8-3-9-19-47)71-69(73-70)48-20-10-4-11-21-48/h2-23,25-44,57,63-64H,24H2,1H3 |
| InChIKey | UBJAOFCUTVGRNT-UHFFFAOYSA-N |
| XLogP | 16.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.21 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |