C63H50N6 — CID 170002503
9-[2-(3,6-dimethyl-4a,9a-dihydrocarbazol-9-yl)-6-(3,6-dimethylcarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole (PubChem CID 170002503) has the molecular formula C63H50N6 and a molecular weight of 891.14 g/mol. Its IUPAC name is 9-[2-(3,6-dimethyl-4a,9a-dihydrocarbazol-9-yl)-6-(3,6-dimethylcarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[2-(3,6-dimethyl-4a,9a-dihydrocarbazol-9-yl)-6-(3,6-dimethylcarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 170002503 |
| Molecular Formula | C63H50N6 |
| Molecular Weight | 891.14 g/mol |
| Exact Mass | 890.41 |
| IUPAC Name | 9-[2-(3,6-dimethyl-4a,9a-dihydrocarbazol-9-yl)-6-(3,6-dimethylcarbazol-9-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
| SMILES | CC1=CC2c3cc(C)ccc3N(c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-n4c5ccc(C)cc5c5cc(C)ccc54)c3-n3c4ccc(C)cc4c4cc(C)ccc43)C2C=C1 |
| InChI | InChI=1S/C63H50N6/c1-37-17-23-52-46(29-37)47-30-38(2)18-24-53(47)67(52)58-35-45(63-65-61(43-13-9-7-10-14-43)64-62(66-63)44-15-11-8-12-16-44)36-59(68-54-25-19-39(3)31-48(54)49-32-40(4)20-26-55(49)68)60(58)69-56-27-21-41(5)33-50(56)51-34-42(6)22-28-57(51)69/h7-36,46,52H,1-6H3 |
| InChIKey | KUEFLFBMNXURAT-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.14 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |