C57H46F2N4 — CID 138566171
9-[4-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole (PubChem CID 138566171) has the molecular formula C57H46F2N4 and a molecular weight of 825.02 g/mol. Its IUPAC name is 9-[4-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole.
| Compound Name | 9-[4-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 138566171 |
| Molecular Formula | C57H46F2N4 |
| Molecular Weight | 825.02 g/mol |
| Exact Mass | 824.37 |
| IUPAC Name | 9-[4-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole |
| SMILES | Cc1cc(C)c(C2=CC3c4cc(-c5c(C)cc(C)cc5C)ccc4N(c4ccc(-c5c(F)cccc5F)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)C3C=C2)c(C)c1 |
| InChI | InChI=1S/C57H46F2N4/c1-33-26-35(3)52(36(4)27-33)41-20-23-49-44(30-41)45-31-42(53-37(5)28-34(2)29-38(53)6)21-24-50(45)63(49)51-25-22-43(54-47(58)18-13-19-48(54)59)32-46(51)57-61-55(39-14-9-7-10-15-39)60-56(62-57)40-16-11-8-12-17-40/h7-32,44,49H,1-6H3 |
| InChIKey | UFKIRRRILHWKIE-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.02 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |