C55H40F2N4 — CID 138566209
9-[5-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole (PubChem CID 138566209) has the molecular formula C55H40F2N4 and a molecular weight of 794.95 g/mol. Its IUPAC name is 9-[5-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole.
| Compound Name | 9-[5-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 138566209 |
| Molecular Formula | C55H40F2N4 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | 9-[5-(2,6-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4n(-c4cc(-c5c(F)cccc5F)ccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C55H40F2N4/c1-33-24-34(2)27-42(26-33)39-18-21-44-45-22-19-40(43-28-35(3)25-36(4)29-43)31-50(45)61(49(44)30-39)51-32-41(52-47(56)16-11-17-48(52)57)20-23-46(51)55-59-53(37-12-7-5-8-13-37)58-54(60-55)38-14-9-6-10-15-38/h5-32H,1-4H3 |
| InChIKey | WYGXAUQVJUSFQR-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |