C9H12F3NO3 — CID 121464220
3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]butanoic acid (PubChem CID 121464220) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]butanoic acid.
| Compound Name | 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 121464220 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]amino]butanoic acid |
| SMILES | C/C(=C\C(=O)NC(C)CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3/c1-5(9(10,11)12)3-7(14)13-6(2)4-8(15)16/h3,6H,4H2,1-2H3,(H,13,14)(H,15,16)/b5-3+ |
| InChIKey | CZXNXBNCSAOCCB-HWKANZROSA-N |
| XLogP | 1.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|