C33H31FN6O3 — CID 121468958
2-[3-[6-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoroisoquinolin-1-one (PubChem CID 121468958) has the molecular formula C33H31FN6O3 and a molecular weight of 578.65 g/mol. Its IUPAC name is 2-[3-[6-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoroisoquinolin-1-one.
| Compound Name | 2-[3-[6-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoroisoquinolin-1-one |
|---|---|
| PubChem CID | 121468958 |
| Molecular Formula | C33H31FN6O3 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-[3-[6-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2-(hydroxymethyl)phenyl]-6-cyclopropyl-8-fluoroisoquinolin-1-one |
| SMILES | Nc1cc(-c2cccc(-n3ccc4cc(C5CC5)cc(F)c4c3=O)c2CO)nc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C33H31FN6O3/c34-27-17-22(20-4-5-20)16-21-10-11-40(32(42)31(21)27)29-3-1-2-25(26(29)19-41)28-18-30(35)38-33(37-28)36-23-6-8-24(9-7-23)39-12-14-43-15-13-39/h1-3,6-11,16-18,20,41H,4-5,12-15,19H2,(H3,35,36,37,38) |
| InChIKey | YRMGJROQCCLWRD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|