About 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate
8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate (PubChem CID 121469699) has the molecular formula C24H48O4
and a molecular weight of 400.64 g/mol. Its IUPAC name is 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate.
Molecular Properties
| Compound Name | 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate |
| PubChem CID | 121469699 |
| Molecular Formula | C24H48O4 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate |
| SMILES | CCCCC(CC)COCCOCCCC(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C24H48O4/c1-5-7-15-23(6-2)21-27-20-19-26-17-13-16-24(25)28-18-12-10-8-9-11-14-22(3)4/h22-23H,5-21H2,1-4H3 |
| InChIKey | YZDZVILJDUETTF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate?
The IUPAC name of 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate (CID 121469699) is 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate.
What is the SMILES notation for 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate?
The canonical SMILES for 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate is CCCCC(CC)COCCOCCCC(=O)OCCCCCCCC(C)C.
What is the InChIKey of 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate?
The InChIKey is YZDZVILJDUETTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O4/c1-5-7-15-23(6-2)21-27-20-19-26-17-13-16-24(25)28-18-12-10-8-9-11-14-22(3)4/h22-23H,5-21H2,1-4H3.
What are the key properties of 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate?
8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate has a molecular weight of 400.64 g/mol, XLogP of 6.56, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonyl 4-[2-(2-ethylhexoxy)ethoxy]butanoate is sourced from PubChem (CID 121469699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).