About heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate
heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate (PubChem CID 121469872) has the molecular formula C27H54O6
and a molecular weight of 474.72 g/mol. Its IUPAC name is heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate.
Molecular Properties
| Compound Name | heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate |
| PubChem CID | 121469872 |
| Molecular Formula | C27H54O6 |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate |
| SMILES | CCCCCCCCCCOCCOCCOCCOCCCC(=O)OC(C)CCCCC |
| InChI | InChI=1S/C27H54O6/c1-4-6-8-9-10-11-12-14-18-29-20-22-31-24-25-32-23-21-30-19-15-17-27(28)33-26(3)16-13-7-5-2/h26H,4-25H2,1-3H3 |
| InChIKey | ODVMWLBRCIOFNK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate?
The IUPAC name of heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate (CID 121469872) is heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate.
What is the SMILES notation for heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate?
The canonical SMILES for heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate is CCCCCCCCCCOCCOCCOCCOCCCC(=O)OC(C)CCCCC.
What is the InChIKey of heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate?
The InChIKey is ODVMWLBRCIOFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H54O6/c1-4-6-8-9-10-11-12-14-18-29-20-22-31-24-25-32-23-21-30-19-15-17-27(28)33-26(3)16-13-7-5-2/h26H,4-25H2,1-3H3.
What are the key properties of heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate?
heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate has a molecular weight of 474.72 g/mol, XLogP of 6.49, 27 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 4-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]butanoate is sourced from PubChem (CID 121469872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).