C27H23ClF4N4O2S — CID 121471624
6-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]cinnolin-4-amine (PubChem CID 121471624) has the molecular formula C27H23ClF4N4O2S and a molecular weight of 579.02 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]cinnolin-4-amine.
| Compound Name | 6-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]cinnolin-4-amine |
|---|---|
| PubChem CID | 121471624 |
| Molecular Formula | C27H23ClF4N4O2S |
| Molecular Weight | 579.02 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 6-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]cinnolin-4-amine |
| SMILES | O=S(=O)(N1CCC(Nc2cnnc3ccc(C(c4ccc(F)cc4)c4ccc(Cl)cc4)cc23)CC1)C(F)(F)F |
| InChI | InChI=1S/C27H23ClF4N4O2S/c28-20-6-1-17(2-7-20)26(18-3-8-21(29)9-4-18)19-5-10-24-23(15-19)25(16-33-35-24)34-22-11-13-36(14-12-22)39(37,38)27(30,31)32/h1-10,15-16,22,26H,11-14H2,(H,34,35) |
| InChIKey | LZBCJLHLFHKXQT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.02 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|