C17H27IN2O4 — CID 121472665
tert-butyl N-(1,6-dimethylpyridin-1-ium-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate iodide (PubChem CID 121472665) has the molecular formula C17H27IN2O4 and a molecular weight of 450.32 g/mol. Its IUPAC name is tert-butyl N-(1,6-dimethylpyridin-1-ium-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate iodide.
| Compound Name | tert-butyl N-(1,6-dimethylpyridin-1-ium-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate iodide |
|---|---|
| PubChem CID | 121472665 |
| Molecular Formula | C17H27IN2O4 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | tert-butyl N-(1,6-dimethylpyridin-1-ium-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate iodide |
| SMILES | Cc1ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c[n+]1C.[I-] |
| InChI | InChI=1S/C17H27N2O4.HI/c1-12-9-10-13(11-18(12)8)19(14(20)22-16(2,3)4)15(21)23-17(5,6)7;/h9-11H,1-8H3;1H/q+1;/p-1 |
| InChIKey | VZQHYISIGJSCIM-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|