C24H18Cl2N2O3 — CID 121472936
ethyl 4-[3-(2,4-dichloropyridine-3-carbonyl)-2-methylindolizin-1-yl]benzoate (PubChem CID 121472936) has the molecular formula C24H18Cl2N2O3 and a molecular weight of 453.33 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-dichloropyridine-3-carbonyl)-2-methylindolizin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-(2,4-dichloropyridine-3-carbonyl)-2-methylindolizin-1-yl]benzoate |
|---|---|
| PubChem CID | 121472936 |
| Molecular Formula | C24H18Cl2N2O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | ethyl 4-[3-(2,4-dichloropyridine-3-carbonyl)-2-methylindolizin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(C)c(C(=O)c3c(Cl)ccnc3Cl)n3ccccc23)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O3/c1-3-31-24(30)16-9-7-15(8-10-16)19-14(2)21(28-13-5-4-6-18(19)28)22(29)20-17(25)11-12-27-23(20)26/h4-13H,3H2,1-2H3 |
| InChIKey | QWVOGDJIXQLPMD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|