About 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid
4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid (PubChem CID 121472785) has the molecular formula C23H14Cl2FNO3
and a molecular weight of 442.27 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid |
| PubChem CID | 121472785 |
| Molecular Formula | C23H14Cl2FNO3 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid |
| SMILES | Cc1c(-c2ccc(C(=O)O)cc2F)c2ccccn2c1C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H14Cl2FNO3/c1-12-19(14-9-8-13(23(29)30)11-17(14)26)18-7-2-3-10-27(18)21(12)22(28)20-15(24)5-4-6-16(20)25/h2-11H,1H3,(H,29,30) |
| InChIKey | KNMPVYAUXGDCCD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid?
The IUPAC name of 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid (CID 121472785) is 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid.
What is the SMILES notation for 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid?
The canonical SMILES for 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid is Cc1c(-c2ccc(C(=O)O)cc2F)c2ccccn2c1C(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid?
The InChIKey is KNMPVYAUXGDCCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2FNO3/c1-12-19(14-9-8-13(23(29)30)11-17(14)26)18-7-2-3-10-27(18)21(12)22(28)20-15(24)5-4-6-16(20)25/h2-11H,1H3,(H,29,30).
What are the key properties of 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid?
4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid has a molecular weight of 442.27 g/mol, XLogP of 6.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dichlorobenzoyl)-2-methylindolizin-1-yl]-3-fluorobenzoic acid is sourced from PubChem (CID 121472785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).