C42H26N2O2 — CID 121475658
1,2,3,4,6,7,8,9-octadeuterio-10-[7-(1,2,3,4,6,7,8,9-octadeuteriophenoxazin-10-yl)triphenylen-2-yl]phenoxazine (PubChem CID 121475658) has the molecular formula C42H26N2O2 and a molecular weight of 606.78 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9-octadeuterio-10-[7-(1,2,3,4,6,7,8,9-octadeuteriophenoxazin-10-yl)triphenylen-2-yl]phenoxazine.
| Compound Name | 1,2,3,4,6,7,8,9-octadeuterio-10-[7-(1,2,3,4,6,7,8,9-octadeuteriophenoxazin-10-yl)triphenylen-2-yl]phenoxazine |
|---|---|
| PubChem CID | 121475658 |
| Molecular Formula | C42H26N2O2 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 1,2,3,4,6,7,8,9-octadeuterio-10-[7-(1,2,3,4,6,7,8,9-octadeuteriophenoxazin-10-yl)triphenylen-2-yl]phenoxazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Oc1c([2H])c([2H])c([2H])c([2H])c1N2c1ccc2c3ccc(N4c5c([2H])c([2H])c([2H])c([2H])c5Oc5c([2H])c([2H])c([2H])c([2H])c54)cc3c3ccccc3c2c1 |
| InChI | InChI=1S/C42H26N2O2/c1-2-12-30-29(11-1)33-25-27(43-35-13-3-7-17-39(35)45-40-18-8-4-14-36(40)43)21-23-31(33)32-24-22-28(26-34(30)32)44-37-15-5-9-19-41(37)46-42-20-10-6-16-38(42)44/h1-26H/i3D,4D,5D,6D,7D,8D,9D,10D,13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | JXBBMNNEBBTCJO-MUMPEWGCSA-N |
| XLogP | 12.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|