C38H21N3O4 — CID 162785370
2,8-bis(1,3-benzoxazol-2-yl)-10-(6,7,8,9-tetradeuteriodibenzofuran-3-yl)phenoxazine (PubChem CID 162785370) has the molecular formula C38H21N3O4 and a molecular weight of 587.63 g/mol. Its IUPAC name is 2,8-bis(1,3-benzoxazol-2-yl)-10-(6,7,8,9-tetradeuteriodibenzofuran-3-yl)phenoxazine.
| Compound Name | 2,8-bis(1,3-benzoxazol-2-yl)-10-(6,7,8,9-tetradeuteriodibenzofuran-3-yl)phenoxazine |
|---|---|
| PubChem CID | 162785370 |
| Molecular Formula | C38H21N3O4 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | 2,8-bis(1,3-benzoxazol-2-yl)-10-(6,7,8,9-tetradeuteriodibenzofuran-3-yl)phenoxazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3cc(N4c5cc(-c6nc7ccccc7o6)ccc5Oc5ccc(-c6nc7ccccc7o6)cc54)ccc32)c1[2H] |
| InChI | InChI=1S/C38H21N3O4/c1-4-10-31-25(7-1)26-16-15-24(21-36(26)42-31)41-29-19-22(37-39-27-8-2-5-11-32(27)44-37)13-17-34(29)43-35-18-14-23(20-30(35)41)38-40-28-9-3-6-12-33(28)45-38/h1-21H/i1D,4D,7D,10D |
| InChIKey | ISVKHPKMVOVEQN-CBNPISSWSA-N |
| XLogP | 10.78 |
| TPSA | 77.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |