C46H28N6O2 — CID 170404811
7-(benzotriazol-2-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]phenanthren-2-amine (PubChem CID 170404811) has the molecular formula C46H28N6O2 and a molecular weight of 696.77 g/mol. Its IUPAC name is 7-(benzotriazol-2-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]phenanthren-2-amine.
| Compound Name | 7-(benzotriazol-2-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]phenanthren-2-amine |
|---|---|
| PubChem CID | 170404811 |
| Molecular Formula | C46H28N6O2 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | 7-(benzotriazol-2-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]phenanthren-2-amine |
| SMILES | c1ccc2nn(-c3ccc4c(ccc5cc(N(c6ccc(-c7nc8ccccc8o7)cc6)c6ccc(-c7nc8ccccc8o7)cc6)ccc54)c3)nc2c1 |
| InChI | InChI=1S/C46H28N6O2/c1-2-8-40-39(7-1)49-52(50-40)36-24-26-38-32(28-36)14-13-31-27-35(23-25-37(31)38)51(33-19-15-29(16-20-33)45-47-41-9-3-5-11-43(41)53-45)34-21-17-30(18-22-34)46-48-42-10-4-6-12-44(42)54-46/h1-28H |
| InChIKey | PEBXBXFQDMITFN-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|