C14H25N3O4 — CID 121478243
ethyl 2-[[N,N'-di(butanoyl)carbamimidoyl]-methylamino]acetate (PubChem CID 121478243) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 2-[[N,N'-di(butanoyl)carbamimidoyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[N,N'-di(butanoyl)carbamimidoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 121478243 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | ethyl 2-[[N,N'-di(butanoyl)carbamimidoyl]-methylamino]acetate |
| SMILES | CCCC(=O)/N=C(/NC(=O)CCC)N(C)CC(=O)OCC |
| InChI | InChI=1S/C14H25N3O4/c1-5-8-11(18)15-14(16-12(19)9-6-2)17(4)10-13(20)21-7-3/h5-10H2,1-4H3,(H,15,16,18,19) |
| InChIKey | KQWNUUSWVDFVGM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|