About ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate
ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate (PubChem CID 158295873) has the molecular formula C17H33N3O3
and a molecular weight of 330.49 g/mol. Its IUPAC name is ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate |
| PubChem CID | 158295873 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate |
| SMILES | [2H]C([2H])([2H])N(CC(=O)OCC)/C(N)=N/C(=O)CCCCCCCCCC |
| InChI | InChI=1S/C17H33N3O3/c1-4-6-7-8-9-10-11-12-13-15(21)19-17(18)20(3)14-16(22)23-5-2/h4-14H2,1-3H3,(H2,18,19,21)/i3D3 |
| InChIKey | GLXBVVSXUBHTLT-HPRDVNIFSA-N |
| XLogP | 2.85 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate?
The IUPAC name of ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate (CID 158295873) is ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate.
What is the SMILES notation for ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate?
The canonical SMILES for ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate is [2H]C([2H])([2H])N(CC(=O)OCC)/C(N)=N/C(=O)CCCCCCCCCC.
What is the InChIKey of ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate?
The InChIKey is GLXBVVSXUBHTLT-HPRDVNIFSA-N. The full InChI is InChI=1S/C17H33N3O3/c1-4-6-7-8-9-10-11-12-13-15(21)19-17(18)20(3)14-16(22)23-5-2/h4-14H2,1-3H3,(H2,18,19,21)/i3D3.
What are the key properties of ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate?
ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate has a molecular weight of 330.49 g/mol, XLogP of 2.85, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[trideuteriomethyl-(N'-undecanoylcarbamimidoyl)amino]acetate is sourced from PubChem (CID 158295873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).