About heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate
heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate (PubChem CID 159028224) has the molecular formula C18H35N3O3
and a molecular weight of 341.50 g/mol. Its IUPAC name is heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate.
Molecular Properties
| Compound Name | heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate |
| PubChem CID | 159028224 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate |
| SMILES | CCCCCCCOC(=O)CN(C)/C(N)=N/C(=O)CCCCCC |
| InChI | InChI=1S/C18H35N3O3/c1-4-6-8-10-12-14-24-17(23)15-21(3)18(19)20-16(22)13-11-9-7-5-2/h4-15H2,1-3H3,(H2,19,20,22) |
| InChIKey | HZECZIATOMBWED-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate?
The IUPAC name of heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate (CID 159028224) is heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate.
What is the SMILES notation for heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate?
The canonical SMILES for heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate is CCCCCCCOC(=O)CN(C)/C(N)=N/C(=O)CCCCCC.
What is the InChIKey of heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate?
The InChIKey is HZECZIATOMBWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O3/c1-4-6-8-10-12-14-24-17(23)15-21(3)18(19)20-16(22)13-11-9-7-5-2/h4-15H2,1-3H3,(H2,19,20,22).
What are the key properties of heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate?
heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate has a molecular weight of 341.50 g/mol, XLogP of 3.24, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-[(N'-heptanoylcarbamimidoyl)-methylamino]acetate is sourced from PubChem (CID 159028224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).