C25H33N2O4S+ — CID 121481869
[4-methoxy-3-(4-methyl-1-piperidin-4-ylpiperidin-1-ium-1-yl)sulfonylphenyl]-phenylmethanone (PubChem CID 121481869) has the molecular formula C25H33N2O4S+ and a molecular weight of 457.62 g/mol. Its IUPAC name is [4-methoxy-3-(4-methyl-1-piperidin-4-ylpiperidin-1-ium-1-yl)sulfonylphenyl]-phenylmethanone.
| Compound Name | [4-methoxy-3-(4-methyl-1-piperidin-4-ylpiperidin-1-ium-1-yl)sulfonylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 121481869 |
| Molecular Formula | C25H33N2O4S+ |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [4-methoxy-3-(4-methyl-1-piperidin-4-ylpiperidin-1-ium-1-yl)sulfonylphenyl]-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccc2)cc1S(=O)(=O)[N+]1(C2CCNCC2)CCC(C)CC1 |
| InChI | InChI=1S/C25H33N2O4S/c1-19-12-16-27(17-13-19,22-10-14-26-15-11-22)32(29,30)24-18-21(8-9-23(24)31-2)25(28)20-6-4-3-5-7-20/h3-9,18-19,22,26H,10-17H2,1-2H3/q+1 |
| InChIKey | YVOIYRGEPMYLOQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|