C29H30ClN3O — CID 121481870
1-[4-[4-[(E)-2-[3-chloro-5-(2-methyl-1-pyridin-3-ylprop-1-enyl)phenyl]ethenyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 121481870) has the molecular formula C29H30ClN3O and a molecular weight of 472.03 g/mol. Its IUPAC name is 1-[4-[4-[(E)-2-[3-chloro-5-(2-methyl-1-pyridin-3-ylprop-1-enyl)phenyl]ethenyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[(E)-2-[3-chloro-5-(2-methyl-1-pyridin-3-ylprop-1-enyl)phenyl]ethenyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 121481870 |
| Molecular Formula | C29H30ClN3O |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 1-[4-[4-[(E)-2-[3-chloro-5-(2-methyl-1-pyridin-3-ylprop-1-enyl)phenyl]ethenyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(/C=C/c3cc(Cl)cc(C(=C(C)C)c4cccnc4)c3)cc2)CC1 |
| InChI | InChI=1S/C29H30ClN3O/c1-21(2)29(25-5-4-12-31-20-25)26-17-24(18-27(30)19-26)7-6-23-8-10-28(11-9-23)33-15-13-32(14-16-33)22(3)34/h4-12,17-20H,13-16H2,1-3H3/b7-6+ |
| InChIKey | SRADALBQDLFZOT-VOTSOKGWSA-N |
| XLogP | 6.42 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|