C19H21F3N4O — CID 121483794
3-cyclopentyl-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide (PubChem CID 121483794) has the molecular formula C19H21F3N4O and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-cyclopentyl-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | 3-cyclopentyl-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 121483794 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-cyclopentyl-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
| SMILES | CC1Cn2ncc(C3CCCC3)c2CN1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H21F3N4O/c1-11-9-26-17(14(8-23-26)12-4-2-3-5-12)10-25(11)19(27)24-13-6-15(20)18(22)16(21)7-13/h6-8,11-12H,2-5,9-10H2,1H3,(H,24,27) |
| InChIKey | AOPVXBGBKVWSJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|