C18H20F3N5O4S — CID 134182632
(6S)-3-(4-hydroxy-3-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide (PubChem CID 134182632) has the molecular formula C18H20F3N5O4S and a molecular weight of 459.45 g/mol. Its IUPAC name is (6S)-3-(4-hydroxy-3-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | (6S)-3-(4-hydroxy-3-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 134182632 |
| Molecular Formula | C18H20F3N5O4S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (6S)-3-(4-hydroxy-3-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
| SMILES | CC1C(O)CS(=O)(=O)N1c1cnn2c1CN(C(=O)Nc1cc(F)c(F)c(F)c1)[C@@H](C)C2 |
| InChI | InChI=1S/C18H20F3N5O4S/c1-9-6-25-15(14(5-22-25)26-10(2)16(27)8-31(26,29)30)7-24(9)18(28)23-11-3-12(19)17(21)13(20)4-11/h3-5,9-10,16,27H,6-8H2,1-2H3,(H,23,28)/t9-,10?,16?/m0/s1 |
| InChIKey | MUGFMZWTDLJXQX-CYWKSYIRSA-N |
| XLogP | 1.64 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|