C18H27N3O2 — CID 121494372
1-[di(propan-2-yl)amino]-3-[2-(1H-pyrazol-4-yl)phenoxy]propan-2-ol (PubChem CID 121494372) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[di(propan-2-yl)amino]-3-[2-(1H-pyrazol-4-yl)phenoxy]propan-2-ol.
| Compound Name | 1-[di(propan-2-yl)amino]-3-[2-(1H-pyrazol-4-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 121494372 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-[di(propan-2-yl)amino]-3-[2-(1H-pyrazol-4-yl)phenoxy]propan-2-ol |
| SMILES | CC(C)N(CC(O)COc1ccccc1-c1cn[nH]c1)C(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-13(2)21(14(3)4)11-16(22)12-23-18-8-6-5-7-17(18)15-9-19-20-10-15/h5-10,13-14,16,22H,11-12H2,1-4H3,(H,19,20) |
| InChIKey | LUAXKZZNGDYFDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |