C23H29N3O — CID 121495554
[4-(6-methyl-3-pyridinyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 121495554) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is [4-(6-methyl-3-pyridinyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(6-methyl-3-pyridinyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121495554 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [4-(6-methyl-3-pyridinyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)N3CCCCC3CN3CCCC3)cc2)cn1 |
| InChI | InChI=1S/C23H29N3O/c1-18-7-8-21(16-24-18)19-9-11-20(12-10-19)23(27)26-15-3-2-6-22(26)17-25-13-4-5-14-25/h7-12,16,22H,2-6,13-15,17H2,1H3 |
| InChIKey | QEZVARHKZUIQON-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |